C19H12BrN7O4 — CID 19465268
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(4-cyano-1-phenylpyrazol-5-yl)furan-2-carboxamide (PubChem CID 19465268) has the molecular formula C19H12BrN7O4 and a molecular weight of 482.25 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(4-cyano-1-phenylpyrazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(4-cyano-1-phenylpyrazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19465268 |
| Molecular Formula | C19H12BrN7O4 |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(4-cyano-1-phenylpyrazol-5-yl)furan-2-carboxamide |
| SMILES | N#Cc1cnn(-c2ccccc2)c1NC(=O)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C19H12BrN7O4/c20-15-11-25(24-18(15)27(29)30)10-14-6-7-16(31-14)19(28)23-17-12(8-21)9-22-26(17)13-4-2-1-3-5-13/h1-7,9,11H,10H2,(H,23,28) |
| InChIKey | HVDYKNWPPIXMBJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|