C23H32F3N3O — CID 19535019
N-[1-(1-adamantyl)propyl]-2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 19535019) has the molecular formula C23H32F3N3O and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 19535019 |
| Molecular Formula | C23H32F3N3O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | CCC(NC(=O)C(C)n1nc(C(F)(F)F)cc1C1CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H32F3N3O/c1-3-19(22-10-14-6-15(11-22)8-16(7-14)12-22)27-21(30)13(2)29-18(17-4-5-17)9-20(28-29)23(24,25)26/h9,13-17,19H,3-8,10-12H2,1-2H3,(H,27,30) |
| InChIKey | ONTGBCSRWNFMHV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |