C12H9F3N2OS — CID 19546027
(5E)-3-phenyl-2-sulfanylidene-5-(3,3,3-trifluoropropylidene)imidazolidin-4-one (PubChem CID 19546027) has the molecular formula C12H9F3N2OS and a molecular weight of 286.28 g/mol. Its IUPAC name is (5E)-3-phenyl-2-sulfanylidene-5-(3,3,3-trifluoropropylidene)imidazolidin-4-one.
| Compound Name | (5E)-3-phenyl-2-sulfanylidene-5-(3,3,3-trifluoropropylidene)imidazolidin-4-one |
|---|---|
| PubChem CID | 19546027 |
| Molecular Formula | C12H9F3N2OS |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | (5E)-3-phenyl-2-sulfanylidene-5-(3,3,3-trifluoropropylidene)imidazolidin-4-one |
| SMILES | O=C1/C(=C\CC(F)(F)F)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C12H9F3N2OS/c13-12(14,15)7-6-9-10(18)17(11(19)16-9)8-4-2-1-3-5-8/h1-6H,7H2,(H,16,19)/b9-6+ |
| InChIKey | QAOCTDXKUBHCNK-RMKNXTFCSA-N |
| XLogP | 2.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|