C17H12N2O2S — CID 2836335
5-phenacylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2836335) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 5-phenacylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-phenacylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2836335 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-phenacylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C(C=C1NC(=S)N(c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C17H12N2O2S/c20-15(12-7-3-1-4-8-12)11-14-16(21)19(17(22)18-14)13-9-5-2-6-10-13/h1-11H,(H,18,22) |
| InChIKey | OMFJZCFZTVVTQS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|