C15H20N4OS — CID 19547716
(5E)-3-cyclohexyl-5-[(1-ethylpyrazol-4-yl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547716) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-[(1-ethylpyrazol-4-yl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-5-[(1-ethylpyrazol-4-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547716 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (5E)-3-cyclohexyl-5-[(1-ethylpyrazol-4-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(/C=C2/NC(=S)N(C3CCCCC3)C2=O)cn1 |
| InChI | InChI=1S/C15H20N4OS/c1-2-18-10-11(9-16-18)8-13-14(20)19(15(21)17-13)12-6-4-3-5-7-12/h8-10,12H,2-7H2,1H3,(H,17,21)/b13-8+ |
| InChIKey | JTLMWHGLNBQTBB-MDWZMJQESA-N |
| XLogP | 2.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|