C12H12ClN3OS — CID 91962014
3-cyclopropyl-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one;hydrochloride (PubChem CID 91962014) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is 3-cyclopropyl-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one;hydrochloride.
| Compound Name | 3-cyclopropyl-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 91962014 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 3-cyclopropyl-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one;hydrochloride |
| SMILES | Cl.O=C1C(=Cc2ccncc2)NC(=S)N1C1CC1 |
| InChI | InChI=1S/C12H11N3OS.ClH/c16-11-10(7-8-3-5-13-6-4-8)14-12(17)15(11)9-1-2-9;/h3-7,9H,1-2H2,(H,14,17);1H |
| InChIKey | QTJAMTSLRRNJLK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|