C18H16N2O2S — CID 19548512
(5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548512) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is (5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548512 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(c1ccccc1)N1C(=O)/C(=C/C=C/c2ccco2)NC1=S |
| InChI | InChI=1S/C18H16N2O2S/c1-13(14-7-3-2-4-8-14)20-17(21)16(19-18(20)23)11-5-9-15-10-6-12-22-15/h2-13H,1H3,(H,19,23)/b9-5+,16-11- |
| InChIKey | NBPRRDHRYKZXRS-QHTRCIJJSA-N |
| XLogP | 3.65 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|