C23H16F4N2O3S — CID 19548481
(5Z)-3-(1-phenylethyl)-2-sulfanylidene-5-[[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one (PubChem CID 19548481) has the molecular formula C23H16F4N2O3S and a molecular weight of 476.45 g/mol. Its IUPAC name is (5Z)-3-(1-phenylethyl)-2-sulfanylidene-5-[[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one.
| Compound Name | (5Z)-3-(1-phenylethyl)-2-sulfanylidene-5-[[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 19548481 |
| Molecular Formula | C23H16F4N2O3S |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (5Z)-3-(1-phenylethyl)-2-sulfanylidene-5-[[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one |
| SMILES | CC(c1ccccc1)N1C(=O)/C(=C/c2ccc(COc3c(F)c(F)cc(F)c3F)o2)NC1=S |
| InChI | InChI=1S/C23H16F4N2O3S/c1-12(13-5-3-2-4-6-13)29-22(30)18(28-23(29)33)9-14-7-8-15(32-14)11-31-21-19(26)16(24)10-17(25)20(21)27/h2-10,12H,11H2,1H3,(H,28,33)/b18-9- |
| InChIKey | NOFZNUXSQCCZST-NVMNQCDNSA-N |
| XLogP | 5.23 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|