C26H24N2O3S — CID 5430606
(5Z)-5-[[4-methoxy-3-(phenoxymethyl)phenyl]methylidene]-3-[(1R)-1-phenylethyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 5430606) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is (5Z)-5-[[4-methoxy-3-(phenoxymethyl)phenyl]methylidene]-3-[(1R)-1-phenylethyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[4-methoxy-3-(phenoxymethyl)phenyl]methylidene]-3-[(1R)-1-phenylethyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 5430606 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (5Z)-5-[[4-methoxy-3-(phenoxymethyl)phenyl]methylidene]-3-[(1R)-1-phenylethyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2\NC(=S)N([C@H](C)c3ccccc3)C2=O)cc1COc1ccccc1 |
| InChI | InChI=1S/C26H24N2O3S/c1-18(20-9-5-3-6-10-20)28-25(29)23(27-26(28)32)16-19-13-14-24(30-2)21(15-19)17-31-22-11-7-4-8-12-22/h3-16,18H,17H2,1-2H3,(H,27,32)/b23-16-/t18-/m1/s1 |
| InChIKey | YAKAUQVPFDYFHK-MPGAHLTBSA-N |
| XLogP | 5.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|