C26H23BrN2O3S — CID 17376880
(5E)-5-[[4-[(3-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 17376880) has the molecular formula C26H23BrN2O3S and a molecular weight of 523.45 g/mol. Its IUPAC name is (5E)-5-[[4-[(3-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(3-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 17376880 |
| Molecular Formula | C26H23BrN2O3S |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | (5E)-5-[[4-[(3-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2/NC(=S)N(C(C)c3ccccc3)C2=O)ccc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C26H23BrN2O3S/c1-17(20-8-4-3-5-9-20)29-25(30)22(28-26(29)33)14-18-11-12-23(24(15-18)31-2)32-16-19-7-6-10-21(27)13-19/h3-15,17H,16H2,1-2H3,(H,28,33)/b22-14+ |
| InChIKey | LCYYTLKYXGMDKW-HYARGMPZSA-N |
| XLogP | 5.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|