C28H27ClN2O3S — CID 19548382
(5Z)-5-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548382) has the molecular formula C28H27ClN2O3S and a molecular weight of 507.06 g/mol. Its IUPAC name is (5Z)-5-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548382 |
| Molecular Formula | C28H27ClN2O3S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | (5Z)-5-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2\NC(=S)N(C(C)c3ccccc3)C2=O)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C28H27ClN2O3S/c1-17-12-23(13-18(2)26(17)29)34-16-22-14-20(10-11-25(22)33-4)15-24-27(32)31(28(35)30-24)19(3)21-8-6-5-7-9-21/h5-15,19H,16H2,1-4H3,(H,30,35)/b24-15- |
| InChIKey | PVVDKCHIRLIGGP-IWIPYMOSSA-N |
| XLogP | 6.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|