C27H25ClN2O3S — CID 19548485
(5Z)-5-[[3-[(4-chloro-2-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548485) has the molecular formula C27H25ClN2O3S and a molecular weight of 493.03 g/mol. Its IUPAC name is (5Z)-5-[[3-[(4-chloro-2-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[(4-chloro-2-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548485 |
| Molecular Formula | C27H25ClN2O3S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | (5Z)-5-[[3-[(4-chloro-2-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2\NC(=S)N(C(C)c3ccccc3)C2=O)cc1COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C27H25ClN2O3S/c1-17-13-22(28)10-12-24(17)33-16-21-14-19(9-11-25(21)32-3)15-23-26(31)30(27(34)29-23)18(2)20-7-5-4-6-8-20/h4-15,18H,16H2,1-3H3,(H,29,34)/b23-15- |
| InChIKey | OOJDKJWIVQNPHY-HAHDFKILSA-N |
| XLogP | 6.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|