C23H21N5O4S — CID 19548519
(5Z)-5-[[4-methoxy-3-[(3-nitropyrazol-1-yl)methyl]phenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548519) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is (5Z)-5-[[4-methoxy-3-[(3-nitropyrazol-1-yl)methyl]phenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[4-methoxy-3-[(3-nitropyrazol-1-yl)methyl]phenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548519 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (5Z)-5-[[4-methoxy-3-[(3-nitropyrazol-1-yl)methyl]phenyl]methylidene]-3-(1-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2\NC(=S)N(C(C)c3ccccc3)C2=O)cc1Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H21N5O4S/c1-15(17-6-4-3-5-7-17)27-22(29)19(24-23(27)33)13-16-8-9-20(32-2)18(12-16)14-26-11-10-21(25-26)28(30)31/h3-13,15H,14H2,1-2H3,(H,24,33)/b19-13- |
| InChIKey | UYUDVUJZIIHUNX-UYRXBGFRSA-N |
| XLogP | 3.67 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|