C19H23ClFN5O3 — CID 19553811
1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methyl-3-nitropyrazol-1-yl)butan-1-one (PubChem CID 19553811) has the molecular formula C19H23ClFN5O3 and a molecular weight of 423.88 g/mol. Its IUPAC name is 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methyl-3-nitropyrazol-1-yl)butan-1-one.
| Compound Name | 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methyl-3-nitropyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 19553811 |
| Molecular Formula | C19H23ClFN5O3 |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(5-methyl-3-nitropyrazol-1-yl)butan-1-one |
| SMILES | CCC(C(=O)N1CCN(Cc2c(F)cccc2Cl)CC1)n1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H23ClFN5O3/c1-3-17(25-13(2)11-18(22-25)26(28)29)19(27)24-9-7-23(8-10-24)12-14-15(20)5-4-6-16(14)21/h4-6,11,17H,3,7-10,12H2,1-2H3 |
| InChIKey | QXZFVGMHRZMKMM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|