C17H18BrCl2N5O3 — CID 19560206
3-(4-bromo-3-nitropyrazol-1-yl)-1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 19560206) has the molecular formula C17H18BrCl2N5O3 and a molecular weight of 491.17 g/mol. Its IUPAC name is 3-(4-bromo-3-nitropyrazol-1-yl)-1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(4-bromo-3-nitropyrazol-1-yl)-1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 19560206 |
| Molecular Formula | C17H18BrCl2N5O3 |
| Molecular Weight | 491.17 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 3-(4-bromo-3-nitropyrazol-1-yl)-1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCn1cc(Br)c([N+](=O)[O-])n1)N1CCN(Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H18BrCl2N5O3/c18-13-11-24(21-17(13)25(27)28)5-4-16(26)23-8-6-22(7-9-23)10-12-14(19)2-1-3-15(12)20/h1-3,11H,4-10H2 |
| InChIKey | RCUFHOPJRJJMFV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|