C15H17BrN4O4 — CID 19564562
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-hydroxy-4-nitrophenyl)-2-methylpropanamide (PubChem CID 19564562) has the molecular formula C15H17BrN4O4 and a molecular weight of 397.23 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-hydroxy-4-nitrophenyl)-2-methylpropanamide.
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-hydroxy-4-nitrophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 19564562 |
| Molecular Formula | C15H17BrN4O4 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(2-hydroxy-4-nitrophenyl)-2-methylpropanamide |
| SMILES | Cc1nn(CC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2O)c(C)c1Br |
| InChI | InChI=1S/C15H17BrN4O4/c1-8(7-19-10(3)14(16)9(2)18-19)15(22)17-12-5-4-11(20(23)24)6-13(12)21/h4-6,8,21H,7H2,1-3H3,(H,17,22) |
| InChIKey | SFJLOUKJAUZCGH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|