C18H16F4N6O3 — CID 19568287
2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]propanamide (PubChem CID 19568287) has the molecular formula C18H16F4N6O3 and a molecular weight of 440.36 g/mol. Its IUPAC name is 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]propanamide.
| Compound Name | 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 19568287 |
| Molecular Formula | C18H16F4N6O3 |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]propanamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CC(C)C(=O)Nc1cnn(Cc2c(F)cc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C18H16F4N6O3/c1-9(6-27-10(2)3-15(25-27)28(30)31)18(29)24-11-5-23-26(7-11)8-12-13(19)4-14(20)17(22)16(12)21/h3-5,7,9H,6,8H2,1-2H3,(H,24,29) |
| InChIKey | OULGDWUZUOUZLO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|