C16H29ClN4O — CID 19568730
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-(diethylamino)propyl]-2-methylpropanamide (PubChem CID 19568730) has the molecular formula C16H29ClN4O and a molecular weight of 328.89 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-(diethylamino)propyl]-2-methylpropanamide.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-(diethylamino)propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 19568730 |
| Molecular Formula | C16H29ClN4O |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-(diethylamino)propyl]-2-methylpropanamide |
| SMILES | CCN(CC)CCCNC(=O)C(C)Cn1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C16H29ClN4O/c1-6-20(7-2)10-8-9-18-16(22)12(3)11-21-14(5)15(17)13(4)19-21/h12H,6-11H2,1-5H3,(H,18,22) |
| InChIKey | KYIHOFRFOVQJBV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|