C20H46N4O — CID 142817480
N-[3-[3-[3-aminopropyl(ethyl)amino]propyl-ethylamino]propyl]-2-methylbutanamide;ethane (PubChem CID 142817480) has the molecular formula C20H46N4O and a molecular weight of 358.62 g/mol. Its IUPAC name is N-[3-[3-[3-aminopropyl(ethyl)amino]propyl-ethylamino]propyl]-2-methylbutanamide;ethane.
| Compound Name | N-[3-[3-[3-aminopropyl(ethyl)amino]propyl-ethylamino]propyl]-2-methylbutanamide;ethane |
|---|---|
| PubChem CID | 142817480 |
| Molecular Formula | C20H46N4O |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 358.37 |
| IUPAC Name | N-[3-[3-[3-aminopropyl(ethyl)amino]propyl-ethylamino]propyl]-2-methylbutanamide;ethane |
| SMILES | CC.CCC(C)C(=O)NCCCN(CC)CCCN(CC)CCCN |
| InChI | InChI=1S/C18H40N4O.C2H6/c1-5-17(4)18(23)20-12-9-14-22(7-3)16-10-15-21(6-2)13-8-11-19;1-2/h17H,5-16,19H2,1-4H3,(H,20,23);1-2H3 |
| InChIKey | MCRREISQAYOTLY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|