C13H28N4O2 — CID 43316024
N-(2-aminoethyl)-N'-[5-(diethylamino)pentan-2-yl]oxamide (PubChem CID 43316024) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[5-(diethylamino)pentan-2-yl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[5-(diethylamino)pentan-2-yl]oxamide |
|---|---|
| PubChem CID | 43316024 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | N-(2-aminoethyl)-N'-[5-(diethylamino)pentan-2-yl]oxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)C(=O)NCCN |
| InChI | InChI=1S/C13H28N4O2/c1-4-17(5-2)10-6-7-11(3)16-13(19)12(18)15-9-8-14/h11H,4-10,14H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | RPYJJYNIUOHIFH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|