C9H19N3O3 — CID 64601059
N-(2-aminoethyl)-N'-(4-methoxybutan-2-yl)oxamide (PubChem CID 64601059) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(4-methoxybutan-2-yl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-(4-methoxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 64601059 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | N-(2-aminoethyl)-N'-(4-methoxybutan-2-yl)oxamide |
| SMILES | COCCC(C)NC(=O)C(=O)NCCN |
| InChI | InChI=1S/C9H19N3O3/c1-7(3-6-15-2)12-9(14)8(13)11-5-4-10/h7H,3-6,10H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | WBRMHWLHJCBJAC-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|