C21H28N4O4 — CID 19575313
N,N-dicyclohexyl-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 19575313) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N,N-dicyclohexyl-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19575313 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N,N-dicyclohexyl-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | O=C(c1ccc(Cn2cc([N+](=O)[O-])cn2)o1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H28N4O4/c26-21(24(16-7-3-1-4-8-16)17-9-5-2-6-10-17)20-12-11-19(29-20)15-23-14-18(13-22-23)25(27)28/h11-14,16-17H,1-10,15H2 |
| InChIKey | GCRJFVLLOXJSDV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|