C9H8BrN3OS — CID 19577206
(5Z)-2-amino-5-[(5-bromothiophen-2-yl)methylidene]-1-methylimidazol-4-one (PubChem CID 19577206) has the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(5-bromothiophen-2-yl)methylidene]-1-methylimidazol-4-one.
| Compound Name | (5Z)-2-amino-5-[(5-bromothiophen-2-yl)methylidene]-1-methylimidazol-4-one |
|---|---|
| PubChem CID | 19577206 |
| Molecular Formula | C9H8BrN3OS |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | (5Z)-2-amino-5-[(5-bromothiophen-2-yl)methylidene]-1-methylimidazol-4-one |
| SMILES | CN1C(N)=NC(=O)/C1=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C9H8BrN3OS/c1-13-6(8(14)12-9(13)11)4-5-2-3-7(10)15-5/h2-4H,1H3,(H2,11,12,14)/b6-4- |
| InChIKey | PFVPEVOTVCWDCE-XQRVVYSFSA-N |
| XLogP | 1.64 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|