C12H13N3O2S — CID 6385561
N-[(5Z)-1-methyl-4-oxo-5-(2-thiophen-2-ylethylidene)imidazol-2-yl]acetamide (PubChem CID 6385561) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[(5Z)-1-methyl-4-oxo-5-(2-thiophen-2-ylethylidene)imidazol-2-yl]acetamide.
| Compound Name | N-[(5Z)-1-methyl-4-oxo-5-(2-thiophen-2-ylethylidene)imidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6385561 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[(5Z)-1-methyl-4-oxo-5-(2-thiophen-2-ylethylidene)imidazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)/C(=C/Cc2cccs2)N1C |
| InChI | InChI=1S/C12H13N3O2S/c1-8(16)13-12-14-11(17)10(15(12)2)6-5-9-4-3-7-18-9/h3-4,6-7H,5H2,1-2H3,(H,13,14,16,17)/b10-6- |
| InChIKey | AJCOJTXHSYNPBZ-POHAHGRESA-N |
| XLogP | 1.14 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|