About N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide
N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide (PubChem CID 19577991) has the molecular formula C15H10BrCl2N3O2
and a molecular weight of 415.07 g/mol. Its IUPAC name is N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide.
Molecular Properties
| Compound Name | N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide |
| PubChem CID | 19577991 |
| Molecular Formula | C15H10BrCl2N3O2 |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide |
| SMILES | O=C(N/N=C/c1ccc(Br)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H10BrCl2N3O2/c16-10-3-1-9(2-4-10)8-19-21-15(23)14(22)20-13-7-11(17)5-6-12(13)18/h1-8H,(H,20,22)(H,21,23)/b19-8+ |
| InChIKey | TWXUOBXLJUZHAY-UFWORHAWSA-N |
| XLogP | 3.84 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide?
The IUPAC name of N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide (CID 19577991) is N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide.
What is the SMILES notation for N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide?
The canonical SMILES for N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide is O=C(N/N=C/c1ccc(Br)cc1)C(=O)Nc1cc(Cl)ccc1Cl.
What is the InChIKey of N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide?
The InChIKey is TWXUOBXLJUZHAY-UFWORHAWSA-N. The full InChI is InChI=1S/C15H10BrCl2N3O2/c16-10-3-1-9(2-4-10)8-19-21-15(23)14(22)20-13-7-11(17)5-6-12(13)18/h1-8H,(H,20,22)(H,21,23)/b19-8+.
What are the key properties of N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide?
N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide has a molecular weight of 415.07 g/mol, XLogP of 3.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-(4-bromophenyl)methylideneamino]-N-(2,5-dichlorophenyl)oxamide is sourced from PubChem (CID 19577991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).