C24H18ClFN4O2 — CID 19578405
N-[(E)-[1-[(2-chloro-6-fluorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 19578405) has the molecular formula C24H18ClFN4O2 and a molecular weight of 448.89 g/mol. Its IUPAC name is N-[(E)-[1-[(2-chloro-6-fluorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(E)-[1-[(2-chloro-6-fluorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 19578405 |
| Molecular Formula | C24H18ClFN4O2 |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[(E)-[1-[(2-chloro-6-fluorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1cn(Cc2c(F)cccc2Cl)nc1-c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H18ClFN4O2/c25-21-7-4-8-22(26)20(21)15-30-14-18(23(29-30)16-5-2-1-3-6-16)13-27-28-24(32)17-9-11-19(31)12-10-17/h1-14,31H,15H2,(H,28,32)/b27-13+ |
| InChIKey | ZKXIXVIKBNHKFP-UVHMKAGCSA-N |
| XLogP | 4.86 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|