C12H11F3N4O — CID 19578739
1-methyl-N-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19578739) has the molecular formula C12H11F3N4O and a molecular weight of 284.24 g/mol. Its IUPAC name is 1-methyl-N-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19578739 |
| Molecular Formula | C12H11F3N4O |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-methyl-N-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)cc1C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C12H11F3N4O/c1-19-9(6-10(18-19)12(13,14)15)11(20)17-7-8-4-2-3-5-16-8/h2-6H,7H2,1H3,(H,17,20) |
| InChIKey | WGZUKTAMRSMPJB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |