C18H14N2Na2O7S2 — CID 19579
disodium;4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,6-disulfonate (PubChem CID 19579) has the molecular formula C18H14N2Na2O7S2 and a molecular weight of 480.43 g/mol. Its IUPAC name is disodium;4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,6-disulfonate.
| Compound Name | disodium;4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,6-disulfonate |
|---|---|
| PubChem CID | 19579 |
| Molecular Formula | C18H14N2Na2O7S2 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | disodium;4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,6-disulfonate |
| SMILES | Cc1ccc(/N=N/c2c(O)c(S(=O)(=O)[O-])cc3ccc(S(=O)(=O)[O-])cc23)c(C)c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H16N2O7S2.2Na/c1-10-3-6-15(11(2)7-10)19-20-17-14-9-13(28(22,23)24)5-4-12(14)8-16(18(17)21)29(25,26)27;;/h3-9,21H,1-2H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | DKUHOIWLFSTHJN-LLIZZRELSA-L |
| XLogP | -2.61 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|