C21H20IN3O — CID 19579432
2-(4-iodoanilino)-N-[(E)-naphthalen-2-ylmethylideneamino]butanamide (PubChem CID 19579432) has the molecular formula C21H20IN3O and a molecular weight of 457.32 g/mol. Its IUPAC name is 2-(4-iodoanilino)-N-[(E)-naphthalen-2-ylmethylideneamino]butanamide.
| Compound Name | 2-(4-iodoanilino)-N-[(E)-naphthalen-2-ylmethylideneamino]butanamide |
|---|---|
| PubChem CID | 19579432 |
| Molecular Formula | C21H20IN3O |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-(4-iodoanilino)-N-[(E)-naphthalen-2-ylmethylideneamino]butanamide |
| SMILES | CCC(Nc1ccc(I)cc1)C(=O)N/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H20IN3O/c1-2-20(24-19-11-9-18(22)10-12-19)21(26)25-23-14-15-7-8-16-5-3-4-6-17(16)13-15/h3-14,20,24H,2H2,1H3,(H,25,26)/b23-14+ |
| InChIKey | SEVCWJANJYHQSP-OEAKJJBVSA-N |
| XLogP | 4.79 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|