C18H18BrN3O3 — CID 6989351
(2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromoanilino)butanamide (PubChem CID 6989351) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is (2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromoanilino)butanamide.
| Compound Name | (2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromoanilino)butanamide |
|---|---|
| PubChem CID | 6989351 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(4-bromoanilino)butanamide |
| SMILES | CC[C@@H](Nc1ccc(Br)cc1)C(=O)N/N=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18BrN3O3/c1-2-15(21-14-6-4-13(19)5-7-14)18(23)22-20-10-12-3-8-16-17(9-12)25-11-24-16/h3-10,15,21H,2,11H2,1H3,(H,22,23)/b20-10-/t15-/m1/s1 |
| InChIKey | YFTUXPROUWVBKE-RKQRPNFGSA-N |
| XLogP | 3.52 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|