C10H7F3N4S — CID 19580858
3-(difluoromethyl)-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 19580858) has the molecular formula C10H7F3N4S and a molecular weight of 272.25 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(difluoromethyl)-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 19580858 |
| Molecular Formula | C10H7F3N4S |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-(difluoromethyl)-4-[(E)-(2-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccccc1/C=N/n1c(C(F)F)n[nH]c1=S |
| InChI | InChI=1S/C10H7F3N4S/c11-7-4-2-1-3-6(7)5-14-17-9(8(12)13)15-16-10(17)18/h1-5,8H,(H,16,18)/b14-5+ |
| InChIKey | LVWBFOKKZAXNAR-LHHJGKSTSA-N |
| XLogP | 2.90 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|