C13H11FN6S — CID 1416645
4-[(2-fluorophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 1416645) has the molecular formula C13H11FN6S and a molecular weight of 302.34 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2-fluorophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1416645 |
| Molecular Formula | C13H11FN6S |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-[(2-fluorophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2N=Cc2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C13H11FN6S/c1-8-6-11(17-16-8)12-18-19-13(21)20(12)15-7-9-4-2-3-5-10(9)14/h2-7H,1H3,(H,16,17)(H,19,21) |
| InChIKey | HIAWBHRDWHFMLC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|