C14H12N6O2S — CID 6404164
2-[(Z)-[3-(5-methyl-1H-pyrazol-3-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid (PubChem CID 6404164) has the molecular formula C14H12N6O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[(Z)-[3-(5-methyl-1H-pyrazol-3-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid.
| Compound Name | 2-[(Z)-[3-(5-methyl-1H-pyrazol-3-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 6404164 |
| Molecular Formula | C14H12N6O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[(Z)-[3-(5-methyl-1H-pyrazol-3-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C\c2ccccc2C(=O)O)n[nH]1 |
| InChI | InChI=1S/C14H12N6O2S/c1-8-6-11(17-16-8)12-18-19-14(23)20(12)15-7-9-4-2-3-5-10(9)13(21)22/h2-7H,1H3,(H,16,17)(H,19,23)(H,21,22)/b15-7- |
| InChIKey | GYTZJIJHIGPANV-CHHVJCJISA-N |
| XLogP | 2.22 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|