C15H13BrN6S — CID 6866726
4-[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 6866726) has the molecular formula C15H13BrN6S and a molecular weight of 389.28 g/mol. Its IUPAC name is 4-[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6866726 |
| Molecular Formula | C15H13BrN6S |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 4-[(Z)-[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C\C(Br)=C/c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H13BrN6S/c1-10-7-13(19-18-10)14-20-21-15(23)22(14)17-9-12(16)8-11-5-3-2-4-6-11/h2-9H,1H3,(H,18,19)(H,21,23)/b12-8+,17-9- |
| InChIKey | CAKDRPOEJDZTHD-PFYYBVRVSA-N |
| XLogP | 3.91 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|