C16H16N6OS — CID 12004480
4-[[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 12004480) has the molecular formula C16H16N6OS and a molecular weight of 340.41 g/mol. Its IUPAC name is 4-[[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 12004480 |
| Molecular Formula | C16H16N6OS |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccccc1/C=C/C=Nn1c(-c2cc(C)[nH]n2)n[nH]c1=S |
| InChI | InChI=1S/C16H16N6OS/c1-11-10-13(19-18-11)15-20-21-16(24)22(15)17-9-5-7-12-6-3-4-8-14(12)23-2/h3-10H,1-2H3,(H,18,19)(H,21,24)/b7-5+,17-9? |
| InChIKey | HMGGNGFWZMVINS-CLAYQUPYSA-N |
| XLogP | 3.20 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|