C14H13BrN6OS — CID 6878088
4-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 6878088) has the molecular formula C14H13BrN6OS and a molecular weight of 393.27 g/mol. Its IUPAC name is 4-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6878088 |
| Molecular Formula | C14H13BrN6OS |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 4-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(Br)cc1/C=N/n1c(-c2cc(C)[nH]n2)n[nH]c1=S |
| InChI | InChI=1S/C14H13BrN6OS/c1-8-5-11(18-17-8)13-19-20-14(23)21(13)16-7-9-6-10(15)3-4-12(9)22-2/h3-7H,1-2H3,(H,17,18)(H,20,23)/b16-7+ |
| InChIKey | JUXUXXSPXWCZND-FRKPEAEDSA-N |
| XLogP | 3.29 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|