C13H12N6O2S — CID 136671534
4-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 136671534) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136671534 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C\c2ccc(O)cc2O)n[nH]1 |
| InChI | InChI=1S/C13H12N6O2S/c1-7-4-10(16-15-7)12-17-18-13(22)19(12)14-6-8-2-3-9(20)5-11(8)21/h2-6,20-21H,1H3,(H,15,16)(H,18,22)/b14-6- |
| InChIKey | CROACWHYWNKKAP-NSIKDUERSA-N |
| XLogP | 1.93 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|