C11H10N6S2 — CID 6868074
3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 6868074) has the molecular formula C11H10N6S2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6868074 |
| Molecular Formula | C11H10N6S2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C/c2cccs2)n[nH]1 |
| InChI | InChI=1S/C11H10N6S2/c1-7-5-9(14-13-7)10-15-16-11(18)17(10)12-6-8-3-2-4-19-8/h2-6H,1H3,(H,13,14)(H,16,18)/b12-6+ |
| InChIKey | SYDGILBKBXVCJW-WUXMJOGZSA-N |
| XLogP | 2.58 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|