C22H16N4O2S — CID 162675774
2-[(E)-[3-(3-phenylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid (PubChem CID 162675774) has the molecular formula C22H16N4O2S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[(E)-[3-(3-phenylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid.
| Compound Name | 2-[(E)-[3-(3-phenylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 162675774 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-[(E)-[3-(3-phenylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/C=N/n1c(-c2cccc(-c3ccccc3)c2)n[nH]c1=S |
| InChI | InChI=1S/C22H16N4O2S/c27-21(28)19-12-5-4-9-18(19)14-23-26-20(24-25-22(26)29)17-11-6-10-16(13-17)15-7-2-1-3-8-15/h1-14H,(H,25,29)(H,27,28)/b23-14+ |
| InChIKey | XSMSUIIFLHOLQH-OEAKJJBVSA-N |
| XLogP | 4.86 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|