C15H10N5O2S- — CID 4746046
2-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate (PubChem CID 4746046) has the molecular formula C15H10N5O2S- and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate.
| Compound Name | 2-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 4746046 |
| Molecular Formula | C15H10N5O2S- |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C=Nn1c(-c2ccncc2)n[nH]c1=S |
| InChI | InChI=1S/C15H11N5O2S/c21-14(22)12-4-2-1-3-11(12)9-17-20-13(18-19-15(20)23)10-5-7-16-8-6-10/h1-9H,(H,19,23)(H,21,22)/p-1 |
| InChIKey | PVZUQWWUFOYMJY-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|