C19H14ClF2N5O2S — CID 19580965
4-[[5-[(E)-[3-[chloro(difluoro)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2-methoxyphenyl]methoxy]benzonitrile (PubChem CID 19580965) has the molecular formula C19H14ClF2N5O2S and a molecular weight of 449.87 g/mol. Its IUPAC name is 4-[[5-[(E)-[3-[chloro(difluoro)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2-methoxyphenyl]methoxy]benzonitrile.
| Compound Name | 4-[[5-[(E)-[3-[chloro(difluoro)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2-methoxyphenyl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 19580965 |
| Molecular Formula | C19H14ClF2N5O2S |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 4-[[5-[(E)-[3-[chloro(difluoro)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2-methoxyphenyl]methoxy]benzonitrile |
| SMILES | COc1ccc(/C=N/n2c(C(F)(F)Cl)n[nH]c2=S)cc1COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H14ClF2N5O2S/c1-28-16-7-4-13(10-24-27-17(19(20,21)22)25-26-18(27)30)8-14(16)11-29-15-5-2-12(9-23)3-6-15/h2-8,10H,11H2,1H3,(H,26,30)/b24-10+ |
| InChIKey | MKLGPSJZJULTAQ-YSURURNPSA-N |
| XLogP | 4.57 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|