C18H14Cl2F2N4O2S — CID 4866491
3-[chloro(difluoro)methyl]-4-[[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4866491) has the molecular formula C18H14Cl2F2N4O2S and a molecular weight of 459.31 g/mol. Its IUPAC name is 3-[chloro(difluoro)methyl]-4-[[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[chloro(difluoro)methyl]-4-[[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4866491 |
| Molecular Formula | C18H14Cl2F2N4O2S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 3-[chloro(difluoro)methyl]-4-[[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(C=Nn2c(C(F)(F)Cl)n[nH]c2=S)cc1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2F2N4O2S/c1-27-15-7-2-11(8-12(15)10-28-14-5-3-13(19)4-6-14)9-23-26-16(18(20,21)22)24-25-17(26)29/h2-9H,10H2,1H3,(H,25,29) |
| InChIKey | DCWYXYJCIJQVDB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|