C21H25N3O2 — CID 19581490
N-(1-adamantyl)-1-(phenoxymethyl)pyrazole-3-carboxamide (PubChem CID 19581490) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(phenoxymethyl)pyrazole-3-carboxamide.
| Compound Name | N-(1-adamantyl)-1-(phenoxymethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19581490 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(1-adamantyl)-1-(phenoxymethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccn(COc2ccccc2)n1 |
| InChI | InChI=1S/C21H25N3O2/c25-20(22-21-11-15-8-16(12-21)10-17(9-15)13-21)19-6-7-24(23-19)14-26-18-4-2-1-3-5-18/h1-7,15-17H,8-14H2,(H,22,25) |
| InChIKey | PEOOVHIWXJLHSK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |