C19H16F2N2O4S — CID 19582579
N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2,3-dimethoxybenzamide (PubChem CID 19582579) has the molecular formula C19H16F2N2O4S and a molecular weight of 406.41 g/mol. Its IUPAC name is N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2,3-dimethoxybenzamide.
| Compound Name | N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 19582579 |
| Molecular Formula | C19H16F2N2O4S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2nc(-c3ccc(OC(F)F)cc3)cs2)c1OC |
| InChI | InChI=1S/C19H16F2N2O4S/c1-25-15-5-3-4-13(16(15)26-2)17(24)23-19-22-14(10-28-19)11-6-8-12(9-7-11)27-18(20)21/h3-10,18H,1-2H3,(H,22,23,24) |
| InChIKey | POZAWAKHRPFWHQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |