C20H18N2O5S — CID 7532996
methyl 4-[2-[(2,3-dimethoxybenzoyl)amino]-1,3-thiazol-4-yl]benzoate (PubChem CID 7532996) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is methyl 4-[2-[(2,3-dimethoxybenzoyl)amino]-1,3-thiazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-[(2,3-dimethoxybenzoyl)amino]-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 7532996 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | methyl 4-[2-[(2,3-dimethoxybenzoyl)amino]-1,3-thiazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(NC(=O)c3cccc(OC)c3OC)n2)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c1-25-16-6-4-5-14(17(16)26-2)18(23)22-20-21-15(11-28-20)12-7-9-13(10-8-12)19(24)27-3/h4-11H,1-3H3,(H,21,22,23) |
| InChIKey | KFRPRDCYUGOOHW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |