C19H27NO3S — CID 19583968
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 19583968) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 19583968 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NC(C)C2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C19H27NO3S/c1-13-3-7-17(8-4-13)24(22,23)10-9-19(21)20-14(2)18-12-15-5-6-16(18)11-15/h3-4,7-8,14-16,18H,5-6,9-12H2,1-2H3,(H,20,21) |
| InChIKey | PDNSMSCUSCWXRF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |