C18H25N7O4 — CID 19585684
N-cyclohexyl-1-ethyl-4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxamide (PubChem CID 19585684) has the molecular formula C18H25N7O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-cyclohexyl-1-ethyl-4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxamide.
| Compound Name | N-cyclohexyl-1-ethyl-4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19585684 |
| Molecular Formula | C18H25N7O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-cyclohexyl-1-ethyl-4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)Cn2ncc([N+](=O)[O-])c2C)c(C(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C18H25N7O4/c1-3-23-10-14(17(22-23)18(27)20-13-7-5-4-6-8-13)21-16(26)11-24-12(2)15(9-19-24)25(28)29/h9-10,13H,3-8,11H2,1-2H3,(H,20,27)(H,21,26) |
| InChIKey | ZDTBXZCGKYBJJY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|