C22H21N5O2 — CID 19586823
4-methyl-3,5-bis(3-methylphenyl)-1-[(3-nitropyrazol-1-yl)methyl]pyrazole (PubChem CID 19586823) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-methyl-3,5-bis(3-methylphenyl)-1-[(3-nitropyrazol-1-yl)methyl]pyrazole.
| Compound Name | 4-methyl-3,5-bis(3-methylphenyl)-1-[(3-nitropyrazol-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 19586823 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-methyl-3,5-bis(3-methylphenyl)-1-[(3-nitropyrazol-1-yl)methyl]pyrazole |
| SMILES | Cc1cccc(-c2nn(Cn3ccc([N+](=O)[O-])n3)c(-c3cccc(C)c3)c2C)c1 |
| InChI | InChI=1S/C22H21N5O2/c1-15-6-4-8-18(12-15)21-17(3)22(19-9-5-7-16(2)13-19)26(24-21)14-25-11-10-20(23-25)27(28)29/h4-13H,14H2,1-3H3 |
| InChIKey | PDQUXQACWOEBPG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|