C13H16N4O2 — CID 19588088
1,3-bis(1,5-dimethylpyrazol-4-yl)propane-1,3-dione (PubChem CID 19588088) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,3-bis(1,5-dimethylpyrazol-4-yl)propane-1,3-dione.
| Compound Name | 1,3-bis(1,5-dimethylpyrazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 19588088 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1,3-bis(1,5-dimethylpyrazol-4-yl)propane-1,3-dione |
| SMILES | Cc1c(C(=O)CC(=O)c2cnn(C)c2C)cnn1C |
| InChI | InChI=1S/C13H16N4O2/c1-8-10(6-14-16(8)3)12(18)5-13(19)11-7-15-17(4)9(11)2/h6-7H,5H2,1-4H3 |
| InChIKey | GPQCOHZHUZITGL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|