C18H18N6 — CID 19588182
1-(4-methylphenyl)-3,5-bis(1-methylpyrazol-4-yl)pyrazole (PubChem CID 19588182) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3,5-bis(1-methylpyrazol-4-yl)pyrazole.
| Compound Name | 1-(4-methylphenyl)-3,5-bis(1-methylpyrazol-4-yl)pyrazole |
|---|---|
| PubChem CID | 19588182 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(4-methylphenyl)-3,5-bis(1-methylpyrazol-4-yl)pyrazole |
| SMILES | Cc1ccc(-n2nc(-c3cnn(C)c3)cc2-c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C18H18N6/c1-13-4-6-16(7-5-13)24-18(15-10-20-23(3)12-15)8-17(21-24)14-9-19-22(2)11-14/h4-12H,1-3H3 |
| InChIKey | SFJIWAIEPWEEPX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |